Online Database of Chemicals from Around the World
|
CAS#: 87566-80-1 Product: 10-Methoxy-3-methyl-7-(2-thienyl)-1,2,3,4,4a,5-hexahydropyrazino[1,2-a][1,4]benzodiazepine No suppilers available for the product. |
| Name | 10-Methoxy-3-methyl-7-(2-thienyl)-1,2,3,4,4a,5-hexahydropyrazino[1,2-a][1,4]benzodiazepine |
|---|---|
| Synonyms | 1,2,3,4,4 |
| Molecular Structure | ![CAS#: 87566-80-1, 10-Methoxy-3-methyl-7-(2-thienyl)-1,2,3,4,4a,5-hexahydropyrazino[1,2-a][1,4]benzodiazepine](/moreStructures/87566-80-1.gif) |
| Molecular Formula | C18H21N3OS |
| Molecular Weight | 327.44 |
| CAS Registry Number | 87566-80-1 |
| SMILES | N\3=C(/c1sccc1)c2ccc(OC)cc2N4C(C/3)CN(C)CC4 |
| InChI | 1S/C18H21N3OS/c1-20-7-8-21-13(12-20)11-19-18(17-4-3-9-23-17)15-6-5-14(22-2)10-16(15)21/h3-6,9-10,13H,7-8,11-12H2,1-2H3 |
| InChIKey | SFQDCUZFKUPZFC-UHFFFAOYSA-N |
| Density | 1.29g/cm3 (Cal.) |
|---|---|
| Boiling point | 469.682°C at 760 mmHg (Cal.) |
| Flash point | 237.855°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 10-Methoxy-3-methyl-7-(2-thienyl)-1,2,3,4,4a,5-hexahydropyrazino[1,2-a][1,4]benzodiazepine |