|
CAS#: 87588-66-7 Product: 2-(Diethylamino)ethyl N-hydroxy-4-methylbenzenecarbimidothioate No suppilers available for the product. |
| Name | 2-(Diethylamino)ethyl N-hydroxy-4-methylbenzenecarbimidothioate |
|---|---|
| Synonyms | Dev-B-9; S-(2-(Diethylamino)ethyl) 4-methylbenzothiohydroximate |
| Molecular Structure | ![]() |
| Molecular Formula | C14H22N2OS |
| Molecular Weight | 266.40 |
| CAS Registry Number | 87588-66-7 |
| SMILES | S(/C(=N\O)c1ccc(cc1)C)CCN(CC)CC |
| InChI | 1S/C14H22N2OS/c1-4-16(5-2)10-11-18-14(15-17)13-8-6-12(3)7-9-13/h6-9,17H,4-5,10-11H2,1-3H3/b15-14- |
| InChIKey | QYQLXBZQXGUITO-PFONDFGASA-N |
| Density | 1.048g/cm3 (Cal.) |
|---|---|
| Boiling point | 394.412°C at 760 mmHg (Cal.) |
| Flash point | 192.334°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Diethylamino)ethyl N-hydroxy-4-methylbenzenecarbimidothioate |