|
CAS#: 87668-61-9 Product: O-(2,5-Dichlorophenyl) phosphorodichloridothioate No suppilers available for the product. |
| Name | O-(2,5-Dichlorophenyl) phosphorodichloridothioate |
|---|---|
| Synonyms | Dcppdct |
| Molecular Structure | ![]() |
| Molecular Formula | C6H3Cl4OPS |
| Molecular Weight | 295.94 |
| CAS Registry Number | 87668-61-9 |
| SMILES | Clc1ccc(Cl)cc1OP(Cl)(Cl)=S |
| InChI | 1S/C6H3Cl4OPS/c7-4-1-2-5(8)6(3-4)11-12(9,10)13/h1-3H |
| InChIKey | SZENMFRIUYOZQE-UHFFFAOYSA-N |
| Density | 1.685g/cm3 (Cal.) |
|---|---|
| Boiling point | 338.796°C at 760 mmHg (Cal.) |
| Flash point | 158.698°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for O-(2,5-Dichlorophenyl) phosphorodichloridothioate |