|
CAS#: 87750-50-3 Product: 1-(Phenylsulfonyl)-4-(trifluoromethoxy)benzene No suppilers available for the product. |
| Name | 1-(Phenylsulfonyl)-4-(trifluoromethoxy)benzene |
|---|---|
| Synonyms | 1-(phenylsulphonyl)-4-(trifluoromethoxy)benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C13H9F3O3S |
| Molecular Weight | 302.27 |
| CAS Registry Number | 87750-50-3 |
| EINECS | 289-341-6 |
| SMILES | FC(F)(F)Oc1ccc(cc1)S(=O)(=O)c2ccccc2 |
| InChI | 1S/C13H9F3O3S/c14-13(15,16)19-10-6-8-12(9-7-10)20(17,18)11-4-2-1-3-5-11/h1-9H |
| InChIKey | LQTPOHOWUNBYEE-UHFFFAOYSA-N |
| Density | 1.385g/cm3 (Cal.) |
|---|---|
| Boiling point | 373.882°C at 760 mmHg (Cal.) |
| Flash point | 179.918°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(Phenylsulfonyl)-4-(trifluoromethoxy)benzene |