|
CAS#: 87798-82-1 Product: 1-{4-[4-(2-Methoxyphenyl)-1-piperazinyl]butyl}-3,7-dimethyl-3,7-dihydro-1H-purine-2,6-dione dihydrochloride No suppilers available for the product. |
| Name | 1-{4-[4-(2-Methoxyphenyl)-1-piperazinyl]butyl}-3,7-dimethyl-3,7-dihydro-1H-purine-2,6-dione dihydrochloride |
|---|---|
| Synonyms | 1-(4-(4-( |
| Molecular Structure | ![]() |
| Molecular Formula | C22H32Cl2N6O3 |
| Molecular Weight | 499.43 |
| CAS Registry Number | 87798-82-1 |
| SMILES | Cl.Cl.O=C2c1n(cnc1N(C(=O)N2CCCCN4CCN(c3ccccc3OC)CC4)C)C |
| InChI | 1S/C22H30N6O3.2ClH/c1-24-16-23-20-19(24)21(29)28(22(30)25(20)2)11-7-6-10-26-12-14-27(15-13-26)17-8-4-5-9-18(17)31-3;;/h4-5,8-9,16H,6-7,10-15H2,1-3H3;2*1H |
| InChIKey | YFQSFSDZEVZKAK-UHFFFAOYSA-N |
| Boiling point | 651°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 347.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-{4-[4-(2-Methoxyphenyl)-1-piperazinyl]butyl}-3,7-dimethyl-3,7-dihydro-1H-purine-2,6-dione dihydrochloride |