|
CAS#: 878-17-1 Product: p-Tolyl Phosphorodichloridate No suppilers available for the product. |
| Name | p-Tolyl Phosphorodichloridate |
|---|---|
| Synonyms | 1-Dichlorophosphoryloxy-4-Methyl-Benzene; Nsc66506; P-Tolyl Phosphorodichloridate |
| Molecular Structure | ![]() |
| Molecular Formula | C7H7Cl2O2P |
| Molecular Weight | 225.01 |
| CAS Registry Number | 878-17-1 |
| SMILES | C1=CC(=CC=C1O[P](Cl)(Cl)=O)C |
| InChI | 1S/C7H7Cl2O2P/c1-6-2-4-7(5-3-6)11-12(8,9)10/h2-5H,1H3 |
| InChIKey | OSDCKQFKYUESEG-UHFFFAOYSA-N |
| Density | 1.405g/cm3 (Cal.) |
|---|---|
| Boiling point | 265.164°C at 760 mmHg (Cal.) |
| Flash point | 129.024°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for p-Tolyl Phosphorodichloridate |