|
CAS#: 87848-96-2 Product: 2-Bromo-6-[2-(4-methylphenyl)-1,3-dioxolan-2-yl]pyridine No suppilers available for the product. |
| Name | 2-Bromo-6-[2-(4-methylphenyl)-1,3-dioxolan-2-yl]pyridine |
|---|---|
| Synonyms | 2-bromo-6-[2-(p-tolyl)-1,3-dioxolan-2-yl]pyridine |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14BrNO2 |
| Molecular Weight | 320.18 |
| CAS Registry Number | 87848-96-2 |
| EINECS | 289-351-0 |
| SMILES | Brc1nc(ccc1)C2(OCCO2)c3ccc(cc3)C |
| InChI | 1S/C15H14BrNO2/c1-11-5-7-12(8-6-11)15(18-9-10-19-15)13-3-2-4-14(16)17-13/h2-8H,9-10H2,1H3 |
| InChIKey | WVNVMLQIFKCIQC-UHFFFAOYSA-N |
| Density | 1.434g/cm3 (Cal.) |
|---|---|
| Boiling point | 426.887°C at 760 mmHg (Cal.) |
| Flash point | 211.974°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Bromo-6-[2-(4-methylphenyl)-1,3-dioxolan-2-yl]pyridine |