|
CAS#: 883-80-7 Product: 3-(Tert-Butyl)-1-Methylnaphthalene No suppilers available for the product. |
| Name | 3-(Tert-Butyl)-1-Methylnaphthalene |
|---|---|
| Synonyms | 3-Tert-Butyl-1-Methyl-Naphthalene; 3-(Tert-Butyl)-1-Methylnaphthalene |
| Molecular Structure | ![]() |
| Molecular Formula | C15H18 |
| Molecular Weight | 198.31 |
| CAS Registry Number | 883-80-7 |
| EINECS | 212-933-2 |
| SMILES | C1=C(C=C2C(=C1C)C=CC=C2)C(C)(C)C |
| InChI | 1S/C15H18/c1-11-9-13(15(2,3)4)10-12-7-5-6-8-14(11)12/h5-10H,1-4H3 |
| InChIKey | IRMNGEAZYAGNMC-UHFFFAOYSA-N |
| Density | 0.96g/cm3 (Cal.) |
|---|---|
| Boiling point | 294.152°C at 760 mmHg (Cal.) |
| Flash point | 133.515°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(Tert-Butyl)-1-Methylnaphthalene |