|
CAS#: 884-71-9 Product: 3-Allyl-1-Methyl-1,3-Diazaspiro[4.5]Decane-2,4-Dione No suppilers available for the product. |
| Name | 3-Allyl-1-Methyl-1,3-Diazaspiro[4.5]Decane-2,4-Dione |
|---|---|
| Synonyms | 3-Allyl-1-Methyl-1,3-Diazaspiro[4.5]Decane-2,4-Dione; 3-Allyl-1-Methyl-1,3-Diazaspiro[4.5]Decane-2,4-Quinone; Brn 0789489 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 |
| CAS Registry Number | 884-71-9 |
| SMILES | C(N1C(C2(N(C1=O)C)CCCCC2)=O)C=C |
| InChI | 1S/C12H18N2O2/c1-3-9-14-10(15)12(13(2)11(14)16)7-5-4-6-8-12/h3H,1,4-9H2,2H3 |
| InChIKey | DRACLKJSHZFAEF-UHFFFAOYSA-N |
| Density | 1.156g/cm3 (Cal.) |
|---|---|
| Boiling point | 315.317°C at 760 mmHg (Cal.) |
| Flash point | 126.894°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Allyl-1-Methyl-1,3-Diazaspiro[4.5]Decane-2,4-Dione |