|
CAS#: 885-19-8 Product: 1,4-Dihydroanthraquinone No suppilers available for the product. |
| Name | 1,4-Dihydroanthraquinone |
|---|---|
| Synonyms | 1,4-Dihydroanthracene-9,10-Quinone; 1,4-Dihydroanthraquinone |
| Molecular Structure | ![]() |
| Molecular Formula | C14H10O2 |
| Molecular Weight | 210.23 |
| CAS Registry Number | 885-19-8 |
| EINECS | 212-942-1 |
| SMILES | C1=CC=CC2=C1C(C3=C(C2=O)CC=CC3)=O |
| InChI | 1S/C14H10O2/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13/h1-6H,7-8H2 |
| InChIKey | ZVALGBPJYGUWIS-UHFFFAOYSA-N |
| Density | 1.282g/cm3 (Cal.) |
|---|---|
| Boiling point | 388.737°C at 760 mmHg (Cal.) |
| Flash point | 145.726°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,4-Dihydroanthraquinone |