|
CAS#: 885268-49-5 Product: 4,4'-[5-Chloro-4-(4-hydroxybenzyl)-1H-imidazole-1,2-diyl]diphenol No suppilers available for the product. |
| Name | 4,4'-[5-Chloro-4-(4-hydroxybenzyl)-1H-imidazole-1,2-diyl]diphenol |
|---|---|
| Synonyms | 4,4'-(5-C |
| Molecular Structure | ![]() |
| Molecular Formula | C22H17ClN2O3 |
| Molecular Weight | 392.83 |
| CAS Registry Number | 885268-49-5 |
| SMILES | c1cc(ccc1Cc2c(n(c(n2)c3ccc(cc3)O)c4ccc(cc4)O)Cl)O |
| InChI | 1S/C22H17ClN2O3/c23-21-20(13-14-1-7-17(26)8-2-14)24-22(15-3-9-18(27)10-4-15)25(21)16-5-11-19(28)12-6-16/h1-12,26-28H,13H2 |
| InChIKey | LMXVCPIUMGYJAU-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 680.0±65.0°C at 760 mmHg (Cal.) |
| Flash point | 365.1±34.3°C (Cal.) |
| Refractive index | 1.669 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4'-[5-Chloro-4-(4-hydroxybenzyl)-1H-imidazole-1,2-diyl]diphenol |