|
CAS#: 887-90-1 Product: 5-Bromo-3-(4-Chlorophenyl)-2,1-Benzisoxazole No suppilers available for the product. |
| Name | 5-Bromo-3-(4-Chlorophenyl)-2,1-Benzisoxazole |
|---|---|
| Synonyms | 5-Bromo-3-(4-Chlorophenyl)Anthranil; Nsc406613; Zinc00451427 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H7BrClNO |
| Molecular Weight | 308.56 |
| CAS Registry Number | 887-90-1 |
| SMILES | C1=C(C=CC2=NOC(=C12)C3=CC=C(C=C3)Cl)Br |
| InChI | 1S/C13H7BrClNO/c14-9-3-6-12-11(7-9)13(17-16-12)8-1-4-10(15)5-2-8/h1-7H |
| InChIKey | XPEAUKHERPSOLK-UHFFFAOYSA-N |
| Density | 1.599g/cm3 (Cal.) |
|---|---|
| Boiling point | 439.281°C at 760 mmHg (Cal.) |
| Flash point | 219.47°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Bromo-3-(4-Chlorophenyl)-2,1-Benzisoxazole |