|
CAS#: 89-07-6 Product: 2,4-Dinitrocumene No suppilers available for the product. |
| Name | 2,4-Dinitrocumene |
|---|---|
| Synonyms | 1-Isopropyl-2,4-Dinitro-Benzene; 1-Isopropyl-2,4-Dinitrobenzene; 2,4-Dinitro-1-Propan-2-Yl-Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.19 |
| CAS Registry Number | 89-07-6 |
| EINECS | 201-880-0 |
| SMILES | C1=C([N+](=O)[O-])C=CC(=C1[N+]([O-])=O)C(C)C |
| InChI | 1S/C9H10N2O4/c1-6(2)8-4-3-7(10(12)13)5-9(8)11(14)15/h3-6H,1-2H3 |
| InChIKey | BAWGGSYXBBWRAO-UHFFFAOYSA-N |
| Density | 1.288g/cm3 (Cal.) |
|---|---|
| Boiling point | 333.469°C at 760 mmHg (Cal.) |
| Flash point | 157.87°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Dinitrocumene |