|
CAS#: 887497-69-0 Product: N-[2-(Bromomethyl)Phenyl]-2,2,2-Trifluoroacetimidoyl Chloride No suppilers available for the product. |
| Name | N-[2-(Bromomethyl)Phenyl]-2,2,2-Trifluoroacetimidoyl Chloride |
|---|---|
| Synonyms | (1Z)-N-[2 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H6BrClF3N |
| Molecular Weight | 300.50 |
| CAS Registry Number | 887497-69-0 |
| SMILES | c1ccc(c(c1)CBr)/N=C(/C(F)(F)F)\Cl |
| InChI | 1S/C9H6BrClF3N/c10-5-6-3-1-2-4-7(6)15-8(11)9(12,13)14/h1-4H,5H2/b15-8- |
| InChIKey | HYYXUJRCTJXVAW-NVNXTCNLSA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 275.0±50.0°C at 760 mmHg (Cal.) |
| Flash point | 120.1±30.1°C (Cal.) |
| Refractive index | 1.511 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[2-(Bromomethyl)Phenyl]-2,2,2-Trifluoroacetimidoyl Chloride |