|
CAS#: 89-89-4 Product: 4,4a-Dimethyl-6-Propan-2-Ylidene-4,5,7,8-Tetrahydro-3H-Naphthalen-2-One No suppilers available for the product. |
| Name | 4,4a-Dimethyl-6-Propan-2-Ylidene-4,5,7,8-Tetrahydro-3H-Naphthalen-2-One |
|---|---|
| Synonyms | 6-Isopropylidene-4,4A-Dimethyl-4,5,7,8-Tetrahydro-3H-Naphthalen-2-One; (4R-Cis)-4,4A,5,6,7,8-Hexahydro-4,4A-Dimethyl-6-(1-Methylethylidene)Naphthalen-2(3H)-One; 2(3H)-Naphthalenone, 4,4A,5,6,7,8-Hexahydro-4,4A-Dimethyl-6-(1-Methylethylidene)-, (4R,4As)- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 |
| CAS Registry Number | 89-89-4 |
| SMILES | CC12C(=CC(=O)CC1C)CCC(C2)=C(C)C |
| InChI | 1S/C15H22O/c1-10(2)12-5-6-13-8-14(16)7-11(3)15(13,4)9-12/h8,11H,5-7,9H2,1-4H3 |
| InChIKey | NIIPDXITZPFFTE-UHFFFAOYSA-N |
| Density | 0.98g/cm3 (Cal.) |
|---|---|
| Boiling point | 331.633°C at 760 mmHg (Cal.) |
| Flash point | 147.068°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4a-Dimethyl-6-Propan-2-Ylidene-4,5,7,8-Tetrahydro-3H-Naphthalen-2-One |