Online Database of Chemicals from Around the World
|
CAS#: 89200-08-8 Product: 2,12-Dimethoxy-1,11-dioxopicrasa-2,12-dien-16-yl hexopyranoside No suppilers available for the product. |
| Name | 2,12-Dimethoxy-1,11-dioxopicrasa-2,12-dien-16-yl hexopyranoside |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C28H40O11 |
| Molecular Weight | 552.61 |
| CAS Registry Number | 89200-08-8 |
| SMILES | O=C1C(\OC)=C/C(C)C2C1(C)C4C(=O)C(/OC)=C(/C)C3CC(OC(C2)C34C)OC5OC(C(O)C(O)C5O)CO |
| InChI | 1S/C28H40O11/c1-11-7-15(35-5)25(34)28(4)13(11)8-17-27(3)14(12(2)23(36-6)22(33)24(27)28)9-18(38-17)39-26-21(32)20(31)19(30)16(10-29)37-26/h7,11,13-14,16-21,24,26,29-32H,8-10H2,1-6H3 |
| InChIKey | WBJUWMYAOGSXPY-UHFFFAOYSA-N |
| Density | 1.384g/cm3 (Cal.) |
|---|---|
| Boiling point | 751.977°C at 760 mmHg (Cal.) |
| Flash point | 245.45°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,12-Dimethoxy-1,11-dioxopicrasa-2,12-dien-16-yl hexopyranoside |