Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BioBlocks Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (858) 558-5900 | |||
|
sales@bioblocks.com | |||
| Chemical manufacturer | ||||
| Name | Diethyl 7-bromo-2,3-quinolinedicarboxylate |
|---|---|
| Synonyms | Diethyl 7-bromo-2,3-quinolinedicarboxylate; Diethyl-7-bromo-2,3-quinolinedicarboxylate |
| Molecular Structure |  |
| Molecular Formula | C15H14BrNO4 |
| Molecular Weight | 352.18 |
| CAS Registry Number | 892874-41-8 |
| SMILES | CCOC(=O)c1cc2ccc(Br)cc2nc1C(=O)OCC |
| InChI | 1S/C15H14BrNO4/c1-3-20-14(18)11-7-9-5-6-10(16)8-12(9)17-13(11)15(19)21-4-2/h5-8H,3-4H2,1-2H3 |
| InChIKey | TWIQBJPCMUMTST-UHFFFAOYSA-N |
| Density | 1.457g/cm3 (Cal.) |
|---|---|
| Boiling point | 415.677°C at 760 mmHg (Cal.) |
| Flash point | 205.194°C (Cal.) |
| Refractive index | 1.599 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Diethyl 7-bromo-2,3-quinolinedicarboxylate |