|
CAS#: 89315-17-3 Product: 3-[(1E)-2-(5,5,8,8-Tetramethyl-5,6,7,8-tetrahydro-2-naphthalenyl)-1-propen-1-yl]benzoic acid No suppilers available for the product. |
| Name | 3-[(1E)-2-(5,5,8,8-Tetramethyl-5,6,7,8-tetrahydro-2-naphthalenyl)-1-propen-1-yl]benzoic acid |
|---|---|
| Synonyms | 3-[(E)-2- |
| Molecular Structure | ![]() |
| Molecular Formula | C24H28O2 |
| Molecular Weight | 348.48 |
| CAS Registry Number | 89315-17-3 |
| SMILES | C/C(=C\C1=CC(=CC=C1)C(=O)O)/C2=CC3=C(C=C2)C(CCC3(C)C)(C)C |
| InChI | 1S/C24H28O2/c1-16(13-17-7-6-8-19(14-17)22(25)26)18-9-10-20-21(15-18)24(4,5)12-11-23(20,2)3/h6-10,13-15H,11-12H2,1-5H3,(H,25,26)/b16-13+ |
| InChIKey | FWELAWCPFZMRQA-DTQAZKPQSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 490.6±44.0°C at 760 mmHg (Cal.) |
| Flash point | 229.9±23.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-[(1E)-2-(5,5,8,8-Tetramethyl-5,6,7,8-tetrahydro-2-naphthalenyl)-1-propen-1-yl]benzoic acid |