|
CAS#: 894074-70-5 Product: 4-(4-Cyanophenyl)-2-cyclopropyl-5-methyl-1H-pyrrole-3-carboxylic acid No suppilers available for the product. |
| Name | 4-(4-Cyanophenyl)-2-cyclopropyl-5-methyl-1H-pyrrole-3-carboxylic acid |
|---|---|
| Synonyms | 1H-PYRROL |
| Molecular Structure | ![]() |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.29 |
| CAS Registry Number | 894074-70-5 |
| SMILES | Cc1c(c(c([nH]1)C2CC2)C(=O)O)c3ccc(cc3)C#N |
| InChI | 1S/C16H14N2O2/c1-9-13(11-4-2-10(8-17)3-5-11)14(16(19)20)15(18-9)12-6-7-12/h2-5,12,18H,6-7H2,1H3,(H,19,20) |
| InChIKey | RNJUZRHJURALFR-UHFFFAOYSA-N |
| Density | 1.355g/cm3 (Cal.) |
|---|---|
| Boiling point | 456.494°C at 760 mmHg (Cal.) |
| Flash point | 229.88°C (Cal.) |
| Refractive index | 1.661 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(4-Cyanophenyl)-2-cyclopropyl-5-methyl-1H-pyrrole-3-carboxylic acid |