|
CAS#: 895-37-4 Product: 1,1'-(2-Butene-2,3-diyl)bis(4-methoxybenzene) No suppilers available for the product. |
| Name | 1,1'-(2-Butene-2,3-diyl)bis(4-methoxybenzene) |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.35 |
| CAS Registry Number | 895-37-4 |
| SMILES | O(c2ccc(C(=C(c1ccc(OC)cc1)C)C)cc2)C |
| InChI | 1S/C18H20O2/c1-13(15-5-9-17(19-3)10-6-15)14(2)16-7-11-18(20-4)12-8-16/h5-12H,1-4H3 |
| InChIKey | AVDZRLFBDGAZLP-UHFFFAOYSA-N |
| Density | 1.031g/cm3 (Cal.) |
|---|---|
| Boiling point | 392.55°C at 760 mmHg (Cal.) |
| Flash point | 148.744°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,1'-(2-Butene-2,3-diyl)bis(4-methoxybenzene) |