Online Database of Chemicals from Around the World
|
CAS#: 89705-57-7 Product: L-Tyrosylglycylglycyl-4-bromo-L-phenylalanyl-L-methionine No suppilers available for the product. |
| Name | L-Tyrosylglycylglycyl-4-bromo-L-phenylalanyl-L-methionine |
|---|---|
| Synonyms | 4-(4'-Bromo phe)-met-enkephalin; Enkephalin-met, 4'-bromo-phe(4)- |
| Molecular Structure |  |
| Molecular Formula | C27H34BrN5O7S |
| Molecular Weight | 652.56 |
| CAS Registry Number | 89705-57-7 |
| SMILES | Brc1ccc(cc1)C[C@@H](C(=O)N[C@H](C(=O)O)CCSC)NC(=O)CNC(=O)CNC(=O)[C@@H](N)Cc2ccc(O)cc2 |
| InChI | 1S/C27H34BrN5O7S/c1-41-11-10-21(27(39)40)33-26(38)22(13-17-2-6-18(28)7-3-17)32-24(36)15-30-23(35)14-31-25(37)20(29)12-16-4-8-19(34)9-5-16/h2-9,20-22,34H,10-15,29H2,1H3,(H,30,35)(H,31,37)(H,32,36)(H,33,38)(H,39,40)/t20-,21-,22-/m0/s1 |
| InChIKey | SWIXWMSIOZYRQM-FKBYEOEOSA-N |
| Density | 1.452g/cm3 (Cal.) |
|---|---|
| Boiling point | 1082.97°C at 760 mmHg (Cal.) |
| Flash point | 608.759°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for L-Tyrosylglycylglycyl-4-bromo-L-phenylalanyl-L-methionine |