Online Database of Chemicals from Around the World
|
CAS#: 89945-88-0 Product: 1,4-Bis(2,4-dihydroxyphenyl)-2,3-bis(4-hydroxybenzyl)-1,4-butanedione No suppilers available for the product. |
| Name | 1,4-Bis(2,4-dihydroxyphenyl)-2,3-bis(4-hydroxybenzyl)-1,4-butanedione |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C30H26O8 |
| Molecular Weight | 514.52 |
| CAS Registry Number | 89945-88-0 |
| SMILES | O=C(c1ccc(O)cc1O)C(Cc2ccc(O)cc2)C(Cc3ccc(O)cc3)C(=O)c4ccc(O)cc4O |
| InChI | 1S/C30H26O8/c31-19-5-1-17(2-6-19)13-25(29(37)23-11-9-21(33)15-27(23)35)26(14-18-3-7-20(32)8-4-18)30(38)24-12-10-22(34)16-28(24)36/h1-12,15-16,25-26,31-36H,13-14H2 |
| InChIKey | BSKPRHTXUTXRJW-UHFFFAOYSA-N |
| Density | 1.433g/cm3 (Cal.) |
|---|---|
| Boiling point | 838.348°C at 760 mmHg (Cal.) |
| Flash point | 474.685°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4-Bis(2,4-dihydroxyphenyl)-2,3-bis(4-hydroxybenzyl)-1,4-butanedione |