|
CAS#: 89989-32-2 Product: 2,2-Dimethyl-1,3-propanediyl bis(2,2-dimethyl-1-propanesulfonate) No suppilers available for the product. |
| Name | 2,2-Dimethyl-1,3-propanediyl bis(2,2-dimethyl-1-propanesulfonate) |
|---|---|
| Synonyms | 2,2-DIMET |
| Molecular Structure | ![]() |
| Molecular Formula | C15H32O6S2 |
| Molecular Weight | 372.54 |
| CAS Registry Number | 89989-32-2 |
| SMILES | O=S(=O)(OCC(COS(=O)(=O)CC(C)(C)C)(C)C)CC(C)(C)C |
| InChI | 1S/C15H32O6S2/c1-13(2,3)11-22(16,17)20-9-15(7,8)10-21-23(18,19)12-14(4,5)6/h9-12H2,1-8H3 |
| InChIKey | DHTBMAWUGGKUSV-UHFFFAOYSA-N |
| Density | 1.125g/cm3 (Cal.) |
|---|---|
| Boiling point | 509.509°C at 760 mmHg (Cal.) |
| Flash point | 261.942°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2-Dimethyl-1,3-propanediyl bis(2,2-dimethyl-1-propanesulfonate) |