|
CAS#: 90060-42-7 Product: [6-Methylamino-2-(2-Methylpropanoyloxy)-5,6,7,8-Tetrahydronaphthalen-1-Yl] 2-Methylpropanoate No suppilers available for the product. |
| Name | [6-Methylamino-2-(2-Methylpropanoyloxy)-5,6,7,8-Tetrahydronaphthalen-1-Yl] 2-Methylpropanoate |
|---|---|
| Synonyms | [2-Methylamino-6-(2-Methylpropanoyloxy)Tetralin-5-Yl] 2-Methylpropanoate; 2-Methylpropanoic Acid [2-Methylamino-6-(2-Methyl-1-Oxopropoxy)-5-Tetralinyl] Ester; 2-Methylpropionic Acid (6-Isobutyryloxy-2-Methylamino-Tetralin-5-Yl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 |
| CAS Registry Number | 90060-42-7 |
| SMILES | C1=CC2=C(C(=C1OC(=O)C(C)C)OC(=O)C(C)C)CCC(NC)C2 |
| InChI | 1S/C19H27NO4/c1-11(2)18(21)23-16-9-6-13-10-14(20-5)7-8-15(13)17(16)24-19(22)12(3)4/h6,9,11-12,14,20H,7-8,10H2,1-5H3 |
| InChIKey | OMMYLOLVPCCZQZ-UHFFFAOYSA-N |
| Density | 1.117g/cm3 (Cal.) |
|---|---|
| Boiling point | 456.835°C at 760 mmHg (Cal.) |
| Flash point | 230.086°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [6-Methylamino-2-(2-Methylpropanoyloxy)-5,6,7,8-Tetrahydronaphthalen-1-Yl] 2-Methylpropanoate |