|
CAS#: 9011-09-0 Product: 2-Propenoic acid butyl ester polymer with 1,1-dichloroethene No suppilers available for the product. |
| Name | 2-Propenoic acid butyl ester polymer with 1,1-dichloroethene |
|---|---|
| Synonyms | Butyl Prop-2-Enoate; 1,1-Dichloroethylene; 1,1-Dichloroethylene; Prop-2-Enoic Acid Butyl Ester; Acrylic Acid Butyl Ester; 1,1-Dichloroethylene |
| Molecular Formula | C9H14Cl2O2 |
| Molecular Weight | 225.11 |
| CAS Registry Number | 9011-09-0 |
| SMILES | C(Cl)(Cl)=C.C(OC(=O)C=C)CCC |
| InChI | 1S/C7H12O2.C2H2Cl2/c1-3-5-6-9-7(8)4-2;1-2(3)4/h4H,2-3,5-6H2,1H3;1H2 |
| InChIKey | AILYVBNAYCPJBT-UHFFFAOYSA-N |
| Boiling point | 145.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 39.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Propenoic acid butyl ester polymer with 1,1-dichloroethene |