|
CAS#: 9017-37-2 Product: Methyl methacrylate-divinylbenzene polymer No suppilers available for the product. |
| Name | Methyl methacrylate-divinylbenzene polymer |
|---|---|
| Synonyms | 1,2-Divinylbenzene; Methyl 2-Methylprop-2-Enoate; 1,2-Divinylbenzene; 2-Methylprop-2-Enoic Acid Methyl Ester; 1,2-Divinylbenzene; 2-Methylacrylic Acid Methyl Ester |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 |
| CAS Registry Number | 9017-37-2 |
| SMILES | CC(C(OC)=O)=C.C1=C(C(=CC=C1)C=C)C=C |
| InChI | 1S/C10H10.C5H8O2/c1-3-9-7-5-6-8-10(9)4-2;1-4(2)5(6)7-3/h3-8H,1-2H2;1H2,2-3H3 |
| InChIKey | ZXHDFKAHCABVAF-UHFFFAOYSA-N |
| Boiling point | 207.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 71.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl methacrylate-divinylbenzene polymer |