Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (650) 278-9963 | |||
|
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | Toluene diisocyanate dimer |
|---|---|
| Synonyms | 1,3-Bis(3-Isocyanato-4-Methyl-Phenyl)-1,3-Diazetidine-2,4-Dione; 1,3-Bis(3-Isocyanato-4-Methyl-Phenyl)-1,3-Diazetidine-2,4-Quinone; 1,3-Diazetidine-2,4-Dione, 1,3-Bis(3-Isocyanatomethylphenyl)- |
| Molecular Structure |  |
| Molecular Formula | C18H12N4O4 |
| Molecular Weight | 348.32 |
| CAS Registry Number | 9019-84-5 |
| SMILES | O=C=NC1=CC(=CC=C1C)N2C(=O)N(C2=O)C3=CC=C(C(=C3)N=C=O)C |
| InChI | 1S/C18H12N4O4/c1-11-3-5-13(7-15(11)19-9-23)21-17(25)22(18(21)26)14-6-4-12(2)16(8-14)20-10-24/h3-8H,1-2H3 |
| InChIKey | LOCPTSFJZDIICR-UHFFFAOYSA-N |
| Density | 1.365g/cm3 (Cal.) |
|---|---|
| Boiling point | 497.149°C at 760 mmHg (Cal.) |
| Flash point | 254.467°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Toluene diisocyanate dimer |