|
CAS#: 90210-35-8 Product: 3-(Triethoxysilyl)propyl N,N'-diphenylcarbamimidothioate hydrochloride (1:1) No suppilers available for the product. |
| Name | 3-(Triethoxysilyl)propyl N,N'-diphenylcarbamimidothioate hydrochloride (1:1) |
|---|---|
| Synonyms | 1,3-diphe |
| Molecular Structure | ![]() |
| Molecular Formula | C22H33ClN2O3SSi |
| Molecular Weight | 469.11 |
| CAS Registry Number | 90210-35-8 |
| EINECS | 290-673-9 |
| SMILES | Cl.CCO[Si](OCC)(OCC)CCCS\C(Nc1ccccc1)=N/c2ccccc2 |
| InChI | 1S/C22H32N2O3SSi.ClH/c1-4-25-29(26-5-2,27-6-3)19-13-18-28-22(23-20-14-9-7-10-15-20)24-21-16-11-8-12-17-21;/h7-12,14-17H,4-6,13,18-19H2,1-3H3,(H,23,24);1H |
| InChIKey | XPKLMMUQSDXPMQ-UHFFFAOYSA-N |
| Boiling point | 516.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 266°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(Triethoxysilyl)propyl N,N'-diphenylcarbamimidothioate hydrochloride (1:1) |