|
CAS#: 90275-02-8 Product: 3,4-O-Isopropylidene-3,3',4,5'-tetrahydroxystilbene No suppilers available for the product. |
| Name | 3,4-O-Isopropylidene-3,3',4,5'-tetrahydroxystilbene |
|---|---|
| Synonyms | 5-[(E)-2-(2,2-Dimethyl-1,3-Benzodioxol-5-Yl)Vinyl]Benzene-1,3-Diol; 5-[(E)-2-(2,2-Dimethyl-1,3-Benzodioxol-5-Yl)Vinyl]Resorcinol; (E)-5-(2-(2,2-Dimethyl-1,3-Benzodioxol-5-Yl)Ethenyl)-1,3-Benzenediol |
| Molecular Structure | ![]() |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.31 |
| CAS Registry Number | 90275-02-8 |
| SMILES | C2=C1OC(OC1=CC=C2\C=C\C3=CC(=CC(=C3)O)O)(C)C |
| InChI | 1S/C17H16O4/c1-17(2)20-15-6-5-11(9-16(15)21-17)3-4-12-7-13(18)10-14(19)8-12/h3-10,18-19H,1-2H3/b4-3+ |
| InChIKey | WDSMCLLELZZMDO-ONEGZZNKSA-N |
| Density | 1.298g/cm3 (Cal.) |
|---|---|
| Boiling point | 455.627°C at 760 mmHg (Cal.) |
| Flash point | 229.355°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4-O-Isopropylidene-3,3',4,5'-tetrahydroxystilbene |