|
CAS#: 90417-68-8 Product: 1-(4-Nitrophenyl)-2-amino-3-oxopropanal No suppilers available for the product. |
| Name | 1-(4-Nitrophenyl)-2-amino-3-oxopropanal |
|---|---|
| Synonyms | 2-Amino-3-(4-Nitrophenyl)-3-Oxo-Propanal; 2-Amino-3-Keto-3-(4-Nitrophenyl)Propionaldehyde; 1-(4-Nitrophenyl)-2-Amino-1,3-Propandedione |
| Molecular Structure | ![]() |
| Molecular Formula | C9H8N2O4 |
| Molecular Weight | 208.17 |
| CAS Registry Number | 90417-68-8 |
| SMILES | C1=C(C(=O)C(N)C=O)C=CC(=C1)[N+]([O-])=O |
| InChI | 1S/C9H8N2O4/c10-8(5-12)9(13)6-1-3-7(4-2-6)11(14)15/h1-5,8H,10H2 |
| InChIKey | ZIMDJKOGIYHXMV-UHFFFAOYSA-N |
| Density | 1.381g/cm3 (Cal.) |
|---|---|
| Boiling point | 373.628°C at 760 mmHg (Cal.) |
| Flash point | 179.764°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Nitrophenyl)-2-amino-3-oxopropanal |