|
CAS#: 90520-42-6 Product: Lnd 623 No suppilers available for the product. |
| Name | Lnd 623 |
|---|---|
| Synonyms | (2R,3R,4S,5R,6R)-2-[[(10S,13R,14R,17S)-14-Amino-17-(1-Hydroxyethyl)-10,13-Dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-Tetradecahydrocyclopenta[A]Phenanthren-3-Yl]Oxy]-6-Methyl-Tetrahydropyran-3,4,5-Triol; (2R,3R,4S,5R,6R)-2-[[(10S,13R,14R,17S)-14-Amino-17-(1 |
| Molecular Structure | ![]() |
| Molecular Formula | C27H47NO6 |
| Molecular Weight | 481.67 |
| CAS Registry Number | 90520-42-6 |
| SMILES | [C@H]5(OC1CC[C@]3(C(C1)CCC4[C@@]2(CC[C@H](C(C)O)[C@@]2(C)CCC34)N)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H](O5)C |
| InChI | 1S/C27H47NO6/c1-14(29)18-9-12-27(28)20-6-5-16-13-17(34-24-23(32)22(31)21(30)15(2)33-24)7-10-25(16,3)19(20)8-11-26(18,27)4/h14-24,29-32H,5-13,28H2,1-4H3/t14?,15-,16?,17?,18-,19?,20?,21+,22+,23-,24+,25+,26-,27-/m1/s1 |
| InChIKey | RHGPTBMIKFUPQA-MWTGQHQQSA-N |
| Density | 1.236g/cm3 (Cal.) |
|---|---|
| Boiling point | 611.846°C at 760 mmHg (Cal.) |
| Flash point | 323.833°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Lnd 623 |