|
CAS#: 90606-77-2 Product: 2-Methyl-2-propanyl 3',6'-dihydro-2,4'-bipyridine-1'(2'H)-carboxylate No suppilers available for the product. |
| Name | 2-Methyl-2-propanyl 3',6'-dihydro-2,4'-bipyridine-1'(2'H)-carboxylate |
|---|---|
| Synonyms | 3,6-DIHYD |
| Molecular Structure | ![]() |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.33 |
| CAS Registry Number | 90606-77-2 |
| SMILES | CC(C)(C)OC(=O)N1C\C=C(/CC1)c2ccccn2 |
| InChI | 1S/C15H20N2O2/c1-15(2,3)19-14(18)17-10-7-12(8-11-17)13-6-4-5-9-16-13/h4-7,9H,8,10-11H2,1-3H3 |
| InChIKey | KKKDSTYVFRNJIN-UHFFFAOYSA-N |
| Density | 1.115g/cm3 (Cal.) |
|---|---|
| Boiling point | 379.868°C at 760 mmHg (Cal.) |
| Flash point | 183.538°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-propanyl 3',6'-dihydro-2,4'-bipyridine-1'(2'H)-carboxylate |