|
CAS#: 90769-58-7 Product: 3-(Prop-2-enoxy-prop-1-en-2-yl-phosphoryl)oxyprop-1-ene No suppilers available for the product. |
| Name | 3-(Prop-2-enoxy-prop-1-en-2-yl-phosphoryl)oxyprop-1-ene |
|---|---|
| Synonyms | 3-(Allyloxy-Isopropenyl-Phosphoryl)Oxyprop-1-Ene; 3-(Allyloxy-Isopropenylphosphoryl)Oxyprop-1-Ene; 3-(Prop-2-Enoxy-Prop-1-En-2-Yl-Phosphoryl)Oxyprop-1-Ene |
| Molecular Structure | ![]() |
| Molecular Formula | C9H15O3P |
| Molecular Weight | 202.19 |
| CAS Registry Number | 90769-58-7 |
| SMILES | C(O[P](OCC=C)(C(C)=C)=O)C=C |
| InChI | 1S/C9H15O3P/c1-5-7-11-13(10,9(3)4)12-8-6-2/h5-6H,1-3,7-8H2,4H3 |
| InChIKey | PIWXMVUOAHKIJP-UHFFFAOYSA-N |
| Density | 1.016g/cm3 (Cal.) |
|---|---|
| Boiling point | 251.629°C at 760 mmHg (Cal.) |
| Flash point | 120.051°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(Prop-2-enoxy-prop-1-en-2-yl-phosphoryl)oxyprop-1-ene |