Online Database of Chemicals from Around the World
|
CAS#: 90842-37-8 Product: (2,4,5-Trichlorophenyl) butanoate No suppilers available for the product. |
| Name | (2,4,5-Trichlorophenyl) butanoate |
|---|---|
| Synonyms | Butanoic Acid (2,4,5-Trichlorophenyl) Ester; Butyric Acid (2,4,5-Trichlorophenyl) Ester; Nsc53056 |
| Molecular Structure |  |
| Molecular Formula | C10H9Cl3O2 |
| Molecular Weight | 267.54 |
| CAS Registry Number | 90842-37-8 |
| SMILES | C1=C(C(=CC(=C1OC(CCC)=O)Cl)Cl)Cl |
| InChI | 1S/C10H9Cl3O2/c1-2-3-10(14)15-9-5-7(12)6(11)4-8(9)13/h4-5H,2-3H2,1H3 |
| InChIKey | WPMBWUAEMMVHOS-UHFFFAOYSA-N |
| Density | 1.366g/cm3 (Cal.) |
|---|---|
| Boiling point | 334.343°C at 760 mmHg (Cal.) |
| Flash point | 135.878°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2,4,5-Trichlorophenyl) butanoate |