|
CAS#: 90876-33-8 Product: N,N-Bis(2-chloroethyl)-4-nitro-benzenesulfonamide No suppilers available for the product. |
| Name | N,N-Bis(2-chloroethyl)-4-nitro-benzenesulfonamide |
|---|---|
| Synonyms | N,N-Bis(2-Chloroethyl)-4-Nitro-Benzenesulfonamide; Nsc57823 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12Cl2N2O4S |
| Molecular Weight | 327.18 |
| CAS Registry Number | 90876-33-8 |
| SMILES | C1=C([S](N(CCCl)CCCl)(=O)=O)C=CC(=C1)[N+]([O-])=O |
| InChI | 1S/C10H12Cl2N2O4S/c11-5-7-13(8-6-12)19(17,18)10-3-1-9(2-4-10)14(15)16/h1-4H,5-8H2 |
| InChIKey | YKDCOJVGILKEFG-UHFFFAOYSA-N |
| Density | 1.47g/cm3 (Cal.) |
|---|---|
| Boiling point | 473.357°C at 760 mmHg (Cal.) |
| Flash point | 240.078°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Bis(2-chloroethyl)-4-nitro-benzenesulfonamide |