|
CAS#: 90906-09-5 Product: 1alpha-(4-(N-Succinimidoxycarbonyl)butyryl)mitomycin C No suppilers available for the product. |
| Name | 1alpha-(4-(N-Succinimidoxycarbonyl)butyryl)mitomycin C |
|---|---|
| Synonyms | Mmc-G-Osu; 1Alpha-(4-(N-Succinimidoxycarbonyl)Butyryl)Mitomycin C |
| Molecular Structure | ![]() |
| Molecular Formula | C24H27N5O10 |
| Molecular Weight | 545.50 |
| CAS Registry Number | 90906-09-5 |
| SMILES | [C@@]13(N(C2=C([C@H]1COC(=O)N)C(C(=C(C2=O)C)N)=O)C[C@H]4[C@@H]3N4C(CCCC(=O)ON5C(CCC5=O)=O)=O)OC |
| InChI | 1S/C24H27N5O10/c1-10-18(25)21(35)17-11(9-38-23(26)36)24(37-2)22-12(8-27(24)19(17)20(10)34)28(22)13(30)4-3-5-16(33)39-29-14(31)6-7-15(29)32/h11-12,22H,3-9,25H2,1-2H3,(H2,26,36)/t11-,12+,22+,24-,28?/m1/s1 |
| InChIKey | CTCCPUOPRNRAOW-BOPPWOEFSA-N |
| Density | 1.612g/cm3 (Cal.) |
|---|---|
| Boiling point | 805.367°C at 760 mmHg (Cal.) |
| Flash point | 440.87°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1alpha-(4-(N-Succinimidoxycarbonyl)butyryl)mitomycin C |