|
CAS#: 909670-45-7 Product: 1-(Methylsulfonyl)-4-(1-{[6-(trifluoromethyl)-3-pyridinyl]methyl}-4-piperidinyl)piperazine No suppilers available for the product. |
| Name | 1-(Methylsulfonyl)-4-(1-{[6-(trifluoromethyl)-3-pyridinyl]methyl}-4-piperidinyl)piperazine |
|---|---|
| Synonyms | 1-(methyl |
| Molecular Structure | ![]() |
| Molecular Formula | C17H25F3N4O2S |
| Molecular Weight | 406.47 |
| CAS Registry Number | 909670-45-7 |
| SMILES | FC(F)(F)c1ccc(cn1)CN2CCC(CC2)N3CCN(CC3)S(C)(=O)=O |
| InChI | 1S/C17H25F3N4O2S/c1-27(25,26)24-10-8-23(9-11-24)15-4-6-22(7-5-15)13-14-2-3-16(21-12-14)17(18,19)20/h2-3,12,15H,4-11,13H2,1H3 |
| InChIKey | HXJAXCXJZPWUKV-UHFFFAOYSA-N |
| Density | 1.373g/cm3 (Cal.) |
|---|---|
| Boiling point | 478.686°C at 760 mmHg (Cal.) |
| Flash point | 243.301°C (Cal.) |
| Refractive index | 1.567 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(Methylsulfonyl)-4-(1-{[6-(trifluoromethyl)-3-pyridinyl]methyl}-4-piperidinyl)piperazine |