|
CAS#: 910036-94-1 Product: 2-Methyl-2-propanyl [(2-bromo-3-thienyl)methyl]carbamate No suppilers available for the product. |
| Name | 2-Methyl-2-propanyl [(2-bromo-3-thienyl)methyl]carbamate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C10H14BrNO2S |
| Molecular Weight | 292.19 |
| CAS Registry Number | 910036-94-1 |
| SMILES | CC(C)(C)OC(=O)NCc1ccsc1Br |
| InChI | 1S/C10H14BrNO2S/c1-10(2,3)14-9(13)12-6-7-4-5-15-8(7)11/h4-5H,6H2,1-3H3,(H,12,13) |
| InChIKey | RFNWODFBZMWIEH-UHFFFAOYSA-N |
| Density | 1.416g/cm3 (Cal.) |
|---|---|
| Boiling point | 370.033°C at 760 mmHg (Cal.) |
| Flash point | 177.59°C (Cal.) |
| Refractive index | 1.55 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-propanyl [(2-bromo-3-thienyl)methyl]carbamate |