|
CAS#: 91038-04-9 Product: 4-Nitro-N-tert-Butyldiazenyl-Aniline No suppilers available for the product. |
| Name | 4-Nitro-N-tert-Butyldiazenyl-Aniline |
|---|---|
| Synonyms | N-Tert-Butylazo-4-Nitro-Aniline; N-Tert-Butylazo-4-Nitroaniline; Tert-Butylazo-(4-Nitrophenyl)Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 |
| CAS Registry Number | 91038-04-9 |
| SMILES | C1=CC(=CC=C1[N+]([O-])=O)NN=NC(C)(C)C |
| InChI | 1S/C10H14N4O2/c1-10(2,3)12-13-11-8-4-6-9(7-5-8)14(15)16/h4-7H,1-3H3,(H,11,12) |
| InChIKey | FIUHCPFMGFASDM-UHFFFAOYSA-N |
| Density | 1.186g/cm3 (Cal.) |
|---|---|
| Boiling point | 321.446°C at 760 mmHg (Cal.) |
| Flash point | 148.206°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Nitro-N-tert-Butyldiazenyl-Aniline |