|
CAS#: 91059-32-4 Product: 2-(Trichloromethylsulfanyl)Naphthalene No suppilers available for the product. |
| Name | 2-(Trichloromethylsulfanyl)Naphthalene |
|---|---|
| Synonyms | 2-(Trichloromethylthio)Naphthalene; Nsc68904 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H7Cl3S |
| Molecular Weight | 277.60 |
| CAS Registry Number | 91059-32-4 |
| SMILES | C1=C(C=CC2=C1C=CC=C2)SC(Cl)(Cl)Cl |
| InChI | 1S/C11H7Cl3S/c12-11(13,14)15-10-6-5-8-3-1-2-4-9(8)7-10/h1-7H |
| InChIKey | ZCKJEAOYHPXALY-UHFFFAOYSA-N |
| Density | 1.464g/cm3 (Cal.) |
|---|---|
| Boiling point | 306.68°C at 760 mmHg (Cal.) |
| Flash point | 133.487°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Trichloromethylsulfanyl)Naphthalene |