|
CAS#: 91161-74-9 Product: Punctaporonin A No suppilers available for the product. |
| Name | Punctaporonin A |
|---|---|
| Synonyms | M 95464; M95464; Nsc 382606 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 |
| CAS Registry Number | 91161-74-9 |
| SMILES | C(C23C1CC(C)(C1(CCC2(C(C=C3)O)C)O)C)O |
| InChI | 1S/C15H24O3/c1-12(2)8-10-14(9-16)5-4-11(17)13(14,3)6-7-15(10,12)18/h4-5,10-11,16-18H,6-9H2,1-3H3 |
| InChIKey | ZVIVLLOEKSFGMG-UHFFFAOYSA-N |
| Density | 1.227g/cm3 (Cal.) |
|---|---|
| Boiling point | 381.325°C at 760 mmHg (Cal.) |
| Flash point | 177.349°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Punctaporonin A |