|
CAS#: 91182-56-8 Product: 2-Bromo-3-(Methylamino)-1,4-Naphthalenedione No suppilers available for the product. |
| Name | 2-Bromo-3-(Methylamino)-1,4-Naphthalenedione |
|---|---|
| Synonyms | 2-Bromo-3-Methylamino-Naphthalene-1,4-Dione; 2-Bromo-3-Methylamino-1,4-Naphthoquinone; Aids059733 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H8BrNO2 |
| Molecular Weight | 266.09 |
| CAS Registry Number | 91182-56-8 |
| SMILES | C1=C2C(=CC=C1)C(=O)C(=C(NC)C2=O)Br |
| InChI | 1S/C11H8BrNO2/c1-13-9-8(12)10(14)6-4-2-3-5-7(6)11(9)15/h2-5,13H,1H3 |
| InChIKey | OXCKULWCKUNSQC-UHFFFAOYSA-N |
| Density | 1.648g/cm3 (Cal.) |
|---|---|
| Boiling point | 337.225°C at 760 mmHg (Cal.) |
| Flash point | 157.749°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Bromo-3-(Methylamino)-1,4-Naphthalenedione |