|
CAS#: 912569-55-2 Product: 4,4,5,5-Tetramethyl-2-[2-(phenoxymethyl)phenyl]-1,3,2-dioxaborolane No suppilers available for the product. |
| Name | 4,4,5,5-Tetramethyl-2-[2-(phenoxymethyl)phenyl]-1,3,2-dioxaborolane |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C19H23BO3 |
| Molecular Weight | 310.20 |
| CAS Registry Number | 912569-55-2 |
| SMILES | B1(OC(C(O1)(C)C)(C)C)c2ccccc2COc3ccccc3 |
| InChI | 1S/C19H23BO3/c1-18(2)19(3,4)23-20(22-18)17-13-9-8-10-15(17)14-21-16-11-6-5-7-12-16/h5-13H,14H2,1-4H3 |
| InChIKey | DTPMFYHICLWUGJ-UHFFFAOYSA-N |
| Density | 1.082g/cm3 (Cal.) |
|---|---|
| Boiling point | 433.563°C at 760 mmHg (Cal.) |
| Flash point | 216.012°C (Cal.) |
| Refractive index | 1.544 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4,5,5-Tetramethyl-2-[2-(phenoxymethyl)phenyl]-1,3,2-dioxaborolane |