|
CAS#: 91265-68-8 Product: N-(Cyclopropylmethyl)Normorphinone No suppilers available for the product. |
| Name | N-(Cyclopropylmethyl)Normorphinone |
|---|---|
| Synonyms | N-(Cyclopropylmethyl)Normorphinone; N-Cpmnm |
| Molecular Structure | ![]() |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 |
| CAS Registry Number | 91265-68-8 |
| SMILES | [C@@H]26OC1=C(C=CC3=C1[C@]24[C@H]([C@@H](C3)N(CC4)CC5CC5)C=CC6=O)O |
| InChI | 1S/C20H21NO3/c22-15-5-3-12-9-14-13-4-6-16(23)19-20(13,17(12)18(15)24-19)7-8-21(14)10-11-1-2-11/h3-6,11,13-14,19,22H,1-2,7-10H2/t13-,14+,19-,20-/m0/s1 |
| InChIKey | LJHOJDWHEHQATH-ILWKUFEGSA-N |
| Density | 1.424g/cm3 (Cal.) |
|---|---|
| Boiling point | 524.629°C at 760 mmHg (Cal.) |
| Flash point | 271.086°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(Cyclopropylmethyl)Normorphinone |