|
CAS#: 91324-60-6 Product: 4-(Chloromethyl)-2-(2-Phenylethenyl)-1,3-Dioxolane No suppilers available for the product. |
| Name | 4-(Chloromethyl)-2-(2-Phenylethenyl)-1,3-Dioxolane |
|---|---|
| Synonyms | 4-(Chloromethyl)-2-(2-Phenylethenyl)-1,3-Dioxolane; 4-(Chloromethyl)-2-[(E)-2-Phenylvinyl]-1,3-Dioxolane; 4-(Chloromethyl)-2-(2-Phenylvinyl)-1,3-Dioxolane |
| Molecular Structure | ![]() |
| Molecular Formula | C12H13ClO2 |
| Molecular Weight | 224.69 |
| CAS Registry Number | 91324-60-6 |
| SMILES | C2=C(/C=C/C1OC(CO1)CCl)C=CC=C2 |
| InChI | 1S/C12H13ClO2/c13-8-11-9-14-12(15-11)7-6-10-4-2-1-3-5-10/h1-7,11-12H,8-9H2/b7-6+ |
| InChIKey | LTJFSXKYSVJBLM-VOTSOKGWSA-N |
| Density | 1.239g/cm3 (Cal.) |
|---|---|
| Boiling point | 326.539°C at 760 mmHg (Cal.) |
| Flash point | 127.028°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(Chloromethyl)-2-(2-Phenylethenyl)-1,3-Dioxolane |