|
CAS#: 914-19-2 Product: 2-Methoxy-1,3,4,5-tetraphenylbenzene No suppilers available for the product. |
| Name | 2-Methoxy-1,3,4,5-tetraphenylbenzene |
|---|---|
| Synonyms | Nsc314860 |
| Molecular Structure | ![]() |
| Molecular Formula | C31H24O |
| Molecular Weight | 412.53 |
| CAS Registry Number | 914-19-2 |
| SMILES | C2=C(C(=C(C1=CC=CC=C1)C(=C2C3=CC=CC=C3)OC)C4=CC=CC=C4)C5=CC=CC=C5 |
| InChI | 1S/C31H24O/c1-32-31-28(24-16-8-3-9-17-24)22-27(23-14-6-2-7-15-23)29(25-18-10-4-11-19-25)30(31)26-20-12-5-13-21-26/h2-22H,1H3 |
| InChIKey | MOGBKZPWEDFZQF-UHFFFAOYSA-N |
| Density | 1.101g/cm3 (Cal.) |
|---|---|
| Boiling point | 472.12°C at 760 mmHg (Cal.) |
| Flash point | 194.436°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methoxy-1,3,4,5-tetraphenylbenzene |