|
CAS#: 914776-04-8 Product: 2-Methyl-4-[(trifluoromethyl)sulfonyl]aniline No suppilers available for the product. |
| Name | 2-Methyl-4-[(trifluoromethyl)sulfonyl]aniline |
|---|---|
| Synonyms | 2-methyl-4-(trifluoromethylsulfonyl)benzenamine; 2-Methyl-4-[(trifluormethyl)sulfonyl]anilin; 2-Methyl-4-[(trifluoromethyl)sulfonyl]aniline |
| Molecular Structure | ![]() |
| Molecular Formula | C8H8F3NO2S |
| Molecular Weight | 239.21 |
| CAS Registry Number | 914776-04-8 |
| SMILES | Cc1cc(ccc1N)S(=O)(=O)C(F)(F)F |
| InChI | 1S/C8H8F3NO2S/c1-5-4-6(2-3-7(5)12)15(13,14)8(9,10)11/h2-4H,12H2,1H3 |
| InChIKey | NXQNXENCTZJFKH-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 335.5±42.0°C at 760 mmHg (Cal.) |
| Flash point | 156.7±27.9°C (Cal.) |
| Refractive index | 1.499 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-4-[(trifluoromethyl)sulfonyl]aniline |