|
CAS#: 91587-01-8 Product: Pelretin No suppilers available for the product. |
| Name | Pelretin |
|---|---|
| Synonyms | D05402; Pelretin (Usan); Pelretin |
| Molecular Structure | ![]() |
| Molecular Formula | C23H28O2 |
| Molecular Weight | 336.47 |
| CAS Registry Number | 91587-01-8 |
| SMILES | C1=CC(=CC=C1/C=C/C=C(/C=C/C2=C(CCCC2(C)C)C)C)C(O)=O |
| InChI | 1S/C23H28O2/c1-17(10-15-21-18(2)8-6-16-23(21,3)4)7-5-9-19-11-13-20(14-12-19)22(24)25/h5,7,9-15H,6,8,16H2,1-4H3,(H,24,25)/b9-5+,15-10+,17-7+ |
| InChIKey | YRNAHKPMDMVFMV-GMICYETFSA-N |
| Density | 1.07g/cm3 (Cal.) |
|---|---|
| Boiling point | 506.398°C at 760 mmHg (Cal.) |
| Flash point | 234.881°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Pelretin |