|
CAS#: 91599-21-2 Product: (22R)-14,20,22-Trihydroxy-1-Oxoergosta-3,5,24-Triene-18,26-Dioic Acid 18,20:26,22-Dilactone No suppilers available for the product. |
| Name | (22R)-14,20,22-Trihydroxy-1-Oxoergosta-3,5,24-Triene-18,26-Dioic Acid 18,20:26,22-Dilactone |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C28H34O6 |
| Molecular Weight | 466.57 |
| CAS Registry Number | 91599-21-2 |
| SMILES | [C@]34(O)C1([C@@H]([C@@](OC1=O)([C@@H]2OC(=O)C(=C(C2)C)C)C)CC3)CC[C@H]5[C@H]4CC=C6[C@@]5(C(=O)CC=C6)C |
| InChI | 1S/C28H34O6/c1-15-14-22(33-23(30)16(15)2)26(4)20-11-13-28(32)19-9-8-17-6-5-7-21(29)25(17,3)18(19)10-12-27(20,28)24(31)34-26/h5-6,8,18-20,22,32H,7,9-14H2,1-4H3/t18-,19+,20+,22+,25-,26+,27?,28+/m0/s1 |
| InChIKey | LNINXSFPCHLADE-OZKLRMFXSA-N |
| Density | 1.304g/cm3 (Cal.) |
|---|---|
| Boiling point | 706.265°C at 760 mmHg (Cal.) |
| Flash point | 237.921°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (22R)-14,20,22-Trihydroxy-1-Oxoergosta-3,5,24-Triene-18,26-Dioic Acid 18,20:26,22-Dilactone |