| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Livchem Logistics GmbH | Germany | Inquire | ||
|---|---|---|---|---|
![]() |
+49 (69) 3800-2330 | |||
![]() |
customerservice@livchem.com | |||
| Chemical distributor | ||||
| SelectLab Chemicals GmbH | Germany | Inquire | ||
|---|---|---|---|---|
![]() |
+49 (2383) 919-350 / 919-351 | |||
![]() |
info@selectlab.de, | |||
| Chemical manufacturer | ||||
| Name | 2,2-Dinitropropanol |
|---|---|
| Synonyms | Nsc 17694; Brn 1841531; 1-Propanol, 2,2-Dinitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C3H6N2O5 |
| Molecular Weight | 150.09 |
| CAS Registry Number | 918-52-5 |
| EINECS | 213-043-7 |
| SMILES | C(C([N+](=O)[O-])([N+](=O)[O-])C)O |
| InChI | 1S/C3H6N2O5/c1-3(2-6,4(7)8)5(9)10/h6H,2H2,1H3 |
| InChIKey | IPLRZPREFHIGIB-UHFFFAOYSA-N |
| Density | 1.484g/cm3 (Cal.) |
|---|---|
| Boiling point | 252.793°C at 760 mmHg (Cal.) |
| Flash point | 117.426°C (Cal.) |
| Safety Description | Treat as a potentially harmful and possibly explosive material. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,2-Dinitropropanol |